Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethyl 2-bromothiazole-4-carboxylate, 96%
CAS: 100367-77-9 Molecular Formula: C6H6BrNO2S Molecular Weight (g/mol): 236.09 InChI Key: CNHISCQPKKGDPO-UHFFFAOYSA-N Synonym: ethyl 2-bromothiazole-4-carboxylate,2-bromothiazole-4-carboxylic acid ethyl ester,4-thiazolecarboxylic acid, 2-bromo-, ethyl ester,ethyl2-bromothiazole-4-carboxylate,ethyl 2-bromo-4-thiazolecarboxylate,2-bromo-thiazole-4-carboxylic acid ethyl ester,2-bromo-4-ethoxycarbonyl-1,3-thiazole,2-bromo-1,3-thiazole-4-carboxylic acid ethyl ester,zlchem 490,pubchem17466 PubChem CID: 353965 IUPAC Name: ethyl 2-bromo-1,3-thiazole-4-carboxylate SMILES: CCOC(=O)C1=CSC(=N1)Br
| PubChem CID | 353965 |
|---|---|
| CAS | 100367-77-9 |
| Molecular Weight (g/mol) | 236.09 |
| SMILES | CCOC(=O)C1=CSC(=N1)Br |
| Synonym | ethyl 2-bromothiazole-4-carboxylate,2-bromothiazole-4-carboxylic acid ethyl ester,4-thiazolecarboxylic acid, 2-bromo-, ethyl ester,ethyl2-bromothiazole-4-carboxylate,ethyl 2-bromo-4-thiazolecarboxylate,2-bromo-thiazole-4-carboxylic acid ethyl ester,2-bromo-4-ethoxycarbonyl-1,3-thiazole,2-bromo-1,3-thiazole-4-carboxylic acid ethyl ester,zlchem 490,pubchem17466 |
| IUPAC Name | ethyl 2-bromo-1,3-thiazole-4-carboxylate |
| InChI Key | CNHISCQPKKGDPO-UHFFFAOYSA-N |
| Molecular Formula | C6H6BrNO2S |
Cyclopentene, 95+%
CAS: 142-29-0 Molecular Formula: C5H8 Molecular Weight (g/mol): 68.11 MDL Number: MFCD00001394 InChI Key: LPIQUOYDBNQMRZ-UHFFFAOYSA-N Synonym: 1-cyclopentene,unii-onm2ckv81z,onm2ckv81z,1-cyclopentene #,cyclopentene,cyclopent-2-en-1-yl,cyclopent-3-en-1-yl,dsstox_cid_9171,wln: l5utj,acmc-209co5 PubChem CID: 8882 ChEBI: CHEBI:49155 IUPAC Name: cyclopentene SMILES: C1CC=CC1
| PubChem CID | 8882 |
|---|---|
| CAS | 142-29-0 |
| Molecular Weight (g/mol) | 68.11 |
| ChEBI | CHEBI:49155 |
| MDL Number | MFCD00001394 |
| SMILES | C1CC=CC1 |
| Synonym | 1-cyclopentene,unii-onm2ckv81z,onm2ckv81z,1-cyclopentene #,cyclopentene,cyclopent-2-en-1-yl,cyclopent-3-en-1-yl,dsstox_cid_9171,wln: l5utj,acmc-209co5 |
| IUPAC Name | cyclopentene |
| InChI Key | LPIQUOYDBNQMRZ-UHFFFAOYSA-N |
| Molecular Formula | C5H8 |
Dibutylamine, BAKER ANALYZED™ Reagent, J.T. Baker™
CAS: 111-92-2 Molecular Formula: C8H19N Molecular Weight (g/mol): 129.247 InChI Key: JQVDAXLFBXTEQA-UHFFFAOYSA-N Synonym: dibutylamine,di-n-butylamine,1-butanamine, n-butyl,n-butyl-1-butanamine,dibutilamina,n-dibutylamine,di-n-butyl amine,dibutyl amine,di-normal-butylamine,dibutyl-amine PubChem CID: 8148 IUPAC Name: N-butylbutan-1-amine SMILES: CCCCNCCCC
| PubChem CID | 8148 |
|---|---|
| CAS | 111-92-2 |
| Molecular Weight (g/mol) | 129.247 |
| SMILES | CCCCNCCCC |
| Synonym | dibutylamine,di-n-butylamine,1-butanamine, n-butyl,n-butyl-1-butanamine,dibutilamina,n-dibutylamine,di-n-butyl amine,dibutyl amine,di-normal-butylamine,dibutyl-amine |
| IUPAC Name | N-butylbutan-1-amine |
| InChI Key | JQVDAXLFBXTEQA-UHFFFAOYSA-N |
| Molecular Formula | C8H19N |
Acetic Anhydride, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 108-24-7 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.089 InChI Key: WFDIJRYMOXRFFG-UHFFFAOYSA-N Synonym: acetic anhydride,acetanhydride,acetic acid, anhydride,acetic oxide,acetyl oxide,ethanoic anhydride,acetyl ether,acetyl anhydride,acetic acid anhydride,anhydride acetique PubChem CID: 7918 ChEBI: CHEBI:36610 IUPAC Name: acetyl acetate SMILES: CC(=O)OC(=O)C
| PubChem CID | 7918 |
|---|---|
| CAS | 108-24-7 |
| Molecular Weight (g/mol) | 102.089 |
| ChEBI | CHEBI:36610 |
| SMILES | CC(=O)OC(=O)C |
| Synonym | acetic anhydride,acetanhydride,acetic acid, anhydride,acetic oxide,acetyl oxide,ethanoic anhydride,acetyl ether,acetyl anhydride,acetic acid anhydride,anhydride acetique |
| IUPAC Name | acetyl acetate |
| InChI Key | WFDIJRYMOXRFFG-UHFFFAOYSA-N |
| Molecular Formula | C4H6O3 |
2-Amino-1-methylbenzimidazole, 98+%
CAS: 1622-57-7 Molecular Formula: C8H9N3 Molecular Weight (g/mol): 147.18 MDL Number: MFCD00142855 InChI Key: XDFZKQJLNGNJAN-UHFFFAOYSA-N Synonym: 2-amino-1-methylbenzimidazole,1-methyl-1h-benzimidazol-2-amine,1-methyl-1h-benzo d imidazol-2-amine,1-methyl-2-aminobenzimidazole,1h-benzimidazol-2-amine, 1-methyl,1-methyl-1h-1,3-benzodiazol-2-amine,ccris 4355,2-amino-1-methyl-benzimidazole,1h-benzimidazol-2-amine,1-methyl,1-methyl-1h-benzoimidazol-2-ylamine PubChem CID: 74187 IUPAC Name: 1-methylbenzimidazol-2-amine SMILES: CN1C(N)=NC2=CC=CC=C12
| PubChem CID | 74187 |
|---|---|
| CAS | 1622-57-7 |
| Molecular Weight (g/mol) | 147.18 |
| MDL Number | MFCD00142855 |
| SMILES | CN1C(N)=NC2=CC=CC=C12 |
| Synonym | 2-amino-1-methylbenzimidazole,1-methyl-1h-benzimidazol-2-amine,1-methyl-1h-benzo d imidazol-2-amine,1-methyl-2-aminobenzimidazole,1h-benzimidazol-2-amine, 1-methyl,1-methyl-1h-1,3-benzodiazol-2-amine,ccris 4355,2-amino-1-methyl-benzimidazole,1h-benzimidazol-2-amine,1-methyl,1-methyl-1h-benzoimidazol-2-ylamine |
| IUPAC Name | 1-methylbenzimidazol-2-amine |
| InChI Key | XDFZKQJLNGNJAN-UHFFFAOYSA-N |
| Molecular Formula | C8H9N3 |
Poly(ethylene glycol), average M.W. 1450
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Butylated hydroxyanisole, 96%
CAS: 25013-16-5 Molecular Formula: C11H16O2 Molecular Weight (g/mol): 180.24 MDL Number: MFCD01779059 InChI Key: MRBKEAMVRSLQPH-UHFFFAOYSA-N Synonym: 3-tert-butyl-4-hydroxyanisole,4-hydroxy-3-tert-butylanisole,2-tert-butyl-4-methoxyphenol,3-bha,4-methoxy-2-tert-butylphenol,3-t-butyl-4-hydroxyanisole,phenol, 2-1,1-dimethylethyl-4-methoxy,2-1,1-dimethylethyl-4-methoxyphenol,2-butyl-4-hydroxyanisole,phenol, 2-tert-butyl-4-methoxy PubChem CID: 8456 ChEBI: CHEBI:76358 IUPAC Name: 2-tert-butyl-4-methoxyphenol SMILES: CC(C)(C)C1=C(C=CC(=C1)OC)O
| PubChem CID | 8456 |
|---|---|
| CAS | 25013-16-5 |
| Molecular Weight (g/mol) | 180.24 |
| ChEBI | CHEBI:76358 |
| MDL Number | MFCD01779059 |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)OC)O |
| Synonym | 3-tert-butyl-4-hydroxyanisole,4-hydroxy-3-tert-butylanisole,2-tert-butyl-4-methoxyphenol,3-bha,4-methoxy-2-tert-butylphenol,3-t-butyl-4-hydroxyanisole,phenol, 2-1,1-dimethylethyl-4-methoxy,2-1,1-dimethylethyl-4-methoxyphenol,2-butyl-4-hydroxyanisole,phenol, 2-tert-butyl-4-methoxy |
| IUPAC Name | 2-tert-butyl-4-methoxyphenol |
| InChI Key | MRBKEAMVRSLQPH-UHFFFAOYSA-N |
| Molecular Formula | C11H16O2 |
4-Chloro-3-(trifluoromethyl)phenyl isocyanate, 98%
CAS: 327-78-6 Molecular Formula: C8H3ClF3NO Molecular Weight (g/mol): 221.56 MDL Number: MFCD00013874 InChI Key: NBJZEUQTGLSUOB-UHFFFAOYSA-N Synonym: 4-chloro-3-trifluoromethyl phenyl isocyanate,1-chloro-4-isocyanato-2-trifluoromethyl benzene,4-chloro-3-trifluoromethyl phenylisocyanate,benzene, 1-chloro-4-isocyanato-2-trifluoromethyl,4-chloro-3-trifluoromethylphenyl isocyanate,4-chloro-3-trifluoromethoxy phenyl isocyanate,1-chloro-4-isocyanato-2-trifluoromethyl-benzene,4-chloro-3-trifluoromethyl benzenisocyanate,3-trifluoromethyl-4-chloro-phenyl isocyanate,pubchem5027 PubChem CID: 2733265 IUPAC Name: 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene SMILES: C1=CC(=C(C=C1N=C=O)C(F)(F)F)Cl
| PubChem CID | 2733265 |
|---|---|
| CAS | 327-78-6 |
| Molecular Weight (g/mol) | 221.56 |
| MDL Number | MFCD00013874 |
| SMILES | C1=CC(=C(C=C1N=C=O)C(F)(F)F)Cl |
| Synonym | 4-chloro-3-trifluoromethyl phenyl isocyanate,1-chloro-4-isocyanato-2-trifluoromethyl benzene,4-chloro-3-trifluoromethyl phenylisocyanate,benzene, 1-chloro-4-isocyanato-2-trifluoromethyl,4-chloro-3-trifluoromethylphenyl isocyanate,4-chloro-3-trifluoromethoxy phenyl isocyanate,1-chloro-4-isocyanato-2-trifluoromethyl-benzene,4-chloro-3-trifluoromethyl benzenisocyanate,3-trifluoromethyl-4-chloro-phenyl isocyanate,pubchem5027 |
| IUPAC Name | 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene |
| InChI Key | NBJZEUQTGLSUOB-UHFFFAOYSA-N |
| Molecular Formula | C8H3ClF3NO |
4-Bromophenol, 97%
CAS: 106-41-2 Molecular Formula: C6H5BrO Molecular Weight (g/mol): 173.01 MDL Number: MFCD00002313 InChI Key: GZFGOTFRPZRKDS-UHFFFAOYSA-N Synonym: p-bromophenol,phenol, 4-bromo,p-bromohydroxybenzene,4-bromo-phenol,p-bromophenic acid,phenol, p-bromo,para-bromophenol,4-bromo phenol,unii-lao4j0183i,ccris 632 PubChem CID: 7808 IUPAC Name: 4-bromophenol SMILES: C1=CC(=CC=C1O)Br
| PubChem CID | 7808 |
|---|---|
| CAS | 106-41-2 |
| Molecular Weight (g/mol) | 173.01 |
| MDL Number | MFCD00002313 |
| SMILES | C1=CC(=CC=C1O)Br |
| Synonym | p-bromophenol,phenol, 4-bromo,p-bromohydroxybenzene,4-bromo-phenol,p-bromophenic acid,phenol, p-bromo,para-bromophenol,4-bromo phenol,unii-lao4j0183i,ccris 632 |
| IUPAC Name | 4-bromophenol |
| InChI Key | GZFGOTFRPZRKDS-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrO |
2-(2-Propynyloxy)tetrahydro-2H-pyran, 98%
CAS: 6089-04-9 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.18 MDL Number: MFCD00006604 InChI Key: HQAXHIGPGBPPFU-UHFFFAOYNA-N Synonym: tetrahydro-2-2-propynyloxy-2h-pyran,2-2-propynyloxy tetrahydropyran,2-propargyloxane,2-prop-2-yn-1-yloxy tetrahydro-2h-pyran,2-propargyloxy tetrahydropyran,propargyl 2-tetrahydropyranyl ether,propargyl alcohol tetrahydropyranyl ether,2h-pyran, tetrahydro-2-2-propynyloxy,2-propynyl 2-pyranyl ether,3-2'-tetrahydropyranyloxy propyne PubChem CID: 98609
| PubChem CID | 98609 |
|---|---|
| CAS | 6089-04-9 |
| Molecular Weight (g/mol) | 140.18 |
| MDL Number | MFCD00006604 |
| Synonym | tetrahydro-2-2-propynyloxy-2h-pyran,2-2-propynyloxy tetrahydropyran,2-propargyloxane,2-prop-2-yn-1-yloxy tetrahydro-2h-pyran,2-propargyloxy tetrahydropyran,propargyl 2-tetrahydropyranyl ether,propargyl alcohol tetrahydropyranyl ether,2h-pyran, tetrahydro-2-2-propynyloxy,2-propynyl 2-pyranyl ether,3-2'-tetrahydropyranyloxy propyne |
| InChI Key | HQAXHIGPGBPPFU-UHFFFAOYNA-N |
| Molecular Formula | C8H12O2 |
1-Octanesulfonic acid, sodium salt, HPLC grade
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
4-(Trifluoromethyl)benzenesulfonyl chloride, 98%
CAS: 2991-42-6 Molecular Formula: C7H4ClF3O2S Molecular Weight (g/mol): 244.61 MDL Number: MFCD00042422 InChI Key: OZDCZHDOIBUGAJ-UHFFFAOYSA-N Synonym: 4-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzene-1-sulfonyl chloride,4-trifluoromethyl benzene sulfonyl chloride,p-trifluoromethylbenzenesulfonyl chloride,4-trifluoromethyl benzenesulfonylchloride,4-trifluoromethyl-benzenesulfonyl chloride,4-trifluoromethyl phenylsulfonyl chloride,p-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzenesulphonyl chloride,benzenesulfonyl chloride, 4-trifluoromethyl PubChem CID: 2777399 IUPAC Name: 4-(trifluoromethyl)benzenesulfonyl chloride SMILES: FC(F)(F)C1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 2777399 |
|---|---|
| CAS | 2991-42-6 |
| Molecular Weight (g/mol) | 244.61 |
| MDL Number | MFCD00042422 |
| SMILES | FC(F)(F)C1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | 4-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzene-1-sulfonyl chloride,4-trifluoromethyl benzene sulfonyl chloride,p-trifluoromethylbenzenesulfonyl chloride,4-trifluoromethyl benzenesulfonylchloride,4-trifluoromethyl-benzenesulfonyl chloride,4-trifluoromethyl phenylsulfonyl chloride,p-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzenesulphonyl chloride,benzenesulfonyl chloride, 4-trifluoromethyl |
| IUPAC Name | 4-(trifluoromethyl)benzenesulfonyl chloride |
| InChI Key | OZDCZHDOIBUGAJ-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3O2S |
4-(Chloromethyl)benzoic acid, 98%
CAS: 1642-81-5 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.59 MDL Number: MFCD00002568 InChI Key: OITNBJHJJGMFBN-UHFFFAOYSA-N Synonym: 4-chloromethyl benzoic acid,alpha-chloro-p-toluic acid,benzoic acid, 4-chloromethyl,4-carboxybenzyl chloride,4-chloromethyl-benzoic acid,alpha-chloro-p-toluylic acid,.alpha.-chloro-p-toluylic acid,pubchem15446,alpha-chloroparatoluic acid PubChem CID: 74234 IUPAC Name: 4-(chloromethyl)benzoic acid SMILES: C1=CC(=CC=C1CCl)C(=O)O
| PubChem CID | 74234 |
|---|---|
| CAS | 1642-81-5 |
| Molecular Weight (g/mol) | 170.59 |
| MDL Number | MFCD00002568 |
| SMILES | C1=CC(=CC=C1CCl)C(=O)O |
| Synonym | 4-chloromethyl benzoic acid,alpha-chloro-p-toluic acid,benzoic acid, 4-chloromethyl,4-carboxybenzyl chloride,4-chloromethyl-benzoic acid,alpha-chloro-p-toluylic acid,.alpha.-chloro-p-toluylic acid,pubchem15446,alpha-chloroparatoluic acid |
| IUPAC Name | 4-(chloromethyl)benzoic acid |
| InChI Key | OITNBJHJJGMFBN-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
3-Methyl-2-butenal, 97%
CAS: 107-86-8 Molecular Formula: C5H8O Molecular Weight (g/mol): 84.12 InChI Key: SEPQTYODOKLVSB-UHFFFAOYSA-N Synonym: 3-methyl-2-butenal,prenal,3-methylcrotonaldehyde,senecialdehyde,3,3-dimethylacrolein,senecioaldehyde,2-butenal, 3-methyl,beta,beta-dimethylacrolein,crotonaldehyde, 3-methyl,beta-methylcrotonaldehyde PubChem CID: 61020 ChEBI: CHEBI:15825 IUPAC Name: 3-methylbut-2-enal SMILES: CC(=CC=O)C
| PubChem CID | 61020 |
|---|---|
| CAS | 107-86-8 |
| Molecular Weight (g/mol) | 84.12 |
| ChEBI | CHEBI:15825 |
| SMILES | CC(=CC=O)C |
| Synonym | 3-methyl-2-butenal,prenal,3-methylcrotonaldehyde,senecialdehyde,3,3-dimethylacrolein,senecioaldehyde,2-butenal, 3-methyl,beta,beta-dimethylacrolein,crotonaldehyde, 3-methyl,beta-methylcrotonaldehyde |
| IUPAC Name | 3-methylbut-2-enal |
| InChI Key | SEPQTYODOKLVSB-UHFFFAOYSA-N |
| Molecular Formula | C5H8O |